Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, HPLC of Formula: C8F17I, 507-63-1, Name is Heptadecafluoro-1-iodooctane, SMILES is IC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F, belongs to iodides-buliding-blocks compound. In a document, author is Luo, Jinhua, introduce the new discover.
Electrochemically triggered iodide-vacancy BiOI film for selective extraction of iodide ion from aqueous solutions
The effective extraction and regeneration of radioactive iodide remains an urgent concern for safe nuclear energy utilization. Herein, we developed a novel electrochemically triggered iodide-vacancy BiOI film, which exhibited excellent I- ion extraction capacity of 328.3 mg.g(-1). Especially, due to the ion vacancy trap effect, the film showed high selectivity towards I- ions in the existence of a large number of competitive anions. Additionally, the electrochemically switched ion extraction (ESIE) process with this iodide-vacancy BiOI film possessed fast extraction kinetics and high stability. More importantly, the trapped I(- )ions were easily desorbed from the film without the secondary pollution during the ESIE process and meanwhile, the iodide-vacancy BiOI film was able to be completely regenerated. It is expected that such an iodide-vacancy BiO film with ESIE could become a promising process for the selective extraction of I- ions from the radioactive water.
A reaction mechanism is the microscopic path by which reactants are transformed into products. Each step is an elementary reaction. In my other articles, you can also check out more blogs about 507-63-1. HPLC of Formula: C8F17I.